C14H15NOS2 — CID 126832961
2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfanyl]-1-phenylethanone (PubChem CID 126832961) has the molecular formula C14H15NOS2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfanyl]-1-phenylethanone.
| Compound Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 126832961 |
| Molecular Formula | C14H15NOS2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfanyl]-1-phenylethanone |
| SMILES | Cc1ncsc1CCSCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NOS2/c1-11-14(18-10-15-11)7-8-17-9-13(16)12-5-3-2-4-6-12/h2-6,10H,7-9H2,1H3 |
| InChIKey | MOADUXYJYNYHNF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|