C14H17NO3S — CID 175030808
4-methylbenzoic acid;2-(4-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 175030808) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-methylbenzoic acid;2-(4-methyl-1,3-thiazol-5-yl)ethanol.
| Compound Name | 4-methylbenzoic acid;2-(4-methyl-1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 175030808 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-methylbenzoic acid;2-(4-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1ccc(C(=O)O)cc1.Cc1ncsc1CCO |
| InChI | InChI=1S/C8H8O2.C6H9NOS/c1-6-2-4-7(5-3-6)8(9)10;1-5-6(2-3-8)9-4-7-5/h2-5H,1H3,(H,9,10);4,8H,2-3H2,1H3 |
| InChIKey | LFCFMCOEURPHKO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |