C10H14N2O3S — CID 114899727
2-carbamoyl-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid (PubChem CID 114899727) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-carbamoyl-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid.
| Compound Name | 2-carbamoyl-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 114899727 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-carbamoyl-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid |
| SMILES | Cc1ncsc1CCC(C)(C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H14N2O3S/c1-6-7(16-5-12-6)3-4-10(2,8(11)13)9(14)15/h5H,3-4H2,1-2H3,(H2,11,13)(H,14,15) |
| InChIKey | BEDZGKRWIGTLFK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|