About ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate
ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate (PubChem CID 114290119) has the molecular formula C12H16N2O2S
and a molecular weight of 252.34 g/mol. Its IUPAC name is ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate |
| PubChem CID | 114290119 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate |
| SMILES | CCOC(=O)C(C)(C#N)CCc1scnc1C |
| InChI | InChI=1S/C12H16N2O2S/c1-4-16-11(15)12(3,7-13)6-5-10-9(2)14-8-17-10/h8H,4-6H2,1-3H3 |
| InChIKey | HMQCHLZBXNNXRA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate?
The IUPAC name of ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate (CID 114290119) is ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate.
What is the SMILES notation for ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate?
The canonical SMILES for ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate is CCOC(=O)C(C)(C#N)CCc1scnc1C.
What is the InChIKey of ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate?
The InChIKey is HMQCHLZBXNNXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S/c1-4-16-11(15)12(3,7-13)6-5-10-9(2)14-8-17-10/h8H,4-6H2,1-3H3.
What are the key properties of ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate?
ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate has a molecular weight of 252.34 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-2-methyl-4-(4-methyl-1,3-thiazol-5-yl)butanoate is sourced from PubChem (CID 114290119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).