About 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one
2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one (PubChem CID 79428990) has the molecular formula C12H19NOS
and a molecular weight of 225.36 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one.
Analyze 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one?
The IUPAC name of 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one (CID 79428990) is 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one.
What is the SMILES notation for 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one?
The canonical SMILES for 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one is Cc1ncsc1CCCC(=O)C(C)(C)C.
What is the InChIKey of 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one?
The InChIKey is YIIDOVHJVGBOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NOS/c1-9-10(15-8-13-9)6-5-7-11(14)12(2,3)4/h8H,5-7H2,1-4H3.
What are the key properties of 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one?
2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one has a molecular weight of 225.36 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(4-methyl-1,3-thiazol-5-yl)hexan-3-one is sourced from PubChem (CID 79428990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).