C13H19NO4S — CID 103974382
2-ethoxycarbonyl-2-ethyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid (PubChem CID 103974382) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-ethyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-ethyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 103974382 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-ethoxycarbonyl-2-ethyl-4-(4-methyl-1,3-thiazol-5-yl)butanoic acid |
| SMILES | CCOC(=O)C(CC)(CCc1scnc1C)C(=O)O |
| InChI | InChI=1S/C13H19NO4S/c1-4-13(11(15)16,12(17)18-5-2)7-6-10-9(3)14-8-19-10/h8H,4-7H2,1-3H3,(H,15,16) |
| InChIKey | SQJXGWIGIWFTQY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|