C11H17NO3S — CID 78873948
2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-ethoxypropanoate (PubChem CID 78873948) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-ethoxypropanoate.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-ethoxypropanoate |
|---|---|
| PubChem CID | 78873948 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-ethoxypropanoate |
| SMILES | CCOC(C)C(=O)OCCc1scnc1C |
| InChI | InChI=1S/C11H17NO3S/c1-4-14-9(3)11(13)15-6-5-10-8(2)12-7-16-10/h7,9H,4-6H2,1-3H3 |
| InChIKey | DLUNCIDYGFXKIX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |