C11H17NO3S — CID 43536087
methyl 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]butanoate (PubChem CID 43536087) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is methyl 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]butanoate.
| Compound Name | methyl 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]butanoate |
|---|---|
| PubChem CID | 43536087 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]butanoate |
| SMILES | COC(=O)CC(C)OCCc1scnc1C |
| InChI | InChI=1S/C11H17NO3S/c1-8(6-11(13)14-3)15-5-4-10-9(2)12-7-16-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | WTOQCIPABDZTIO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |