C14H25BrN2O2S — CID 167666489
triethyl-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-2-oxoethyl]azanium bromide (PubChem CID 167666489) has the molecular formula C14H25BrN2O2S and a molecular weight of 365.34 g/mol. Its IUPAC name is triethyl-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-2-oxoethyl]azanium bromide.
| Compound Name | triethyl-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-2-oxoethyl]azanium bromide |
|---|---|
| PubChem CID | 167666489 |
| Molecular Formula | C14H25BrN2O2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | triethyl-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-2-oxoethyl]azanium bromide |
| SMILES | CC[N+](CC)(CC)CC(=O)OCCc1scnc1C.[Br-] |
| InChI | InChI=1S/C14H25N2O2S.BrH/c1-5-16(6-2,7-3)10-14(17)18-9-8-13-12(4)15-11-19-13;/h11H,5-10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PTAYULZFULPBQS-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|