C11H15N3S2 — CID 154754341
4-methyl-5-[2-(2-pyrazol-1-ylethylsulfanyl)ethyl]-1,3-thiazole (PubChem CID 154754341) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 4-methyl-5-[2-(2-pyrazol-1-ylethylsulfanyl)ethyl]-1,3-thiazole.
| Compound Name | 4-methyl-5-[2-(2-pyrazol-1-ylethylsulfanyl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 154754341 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4-methyl-5-[2-(2-pyrazol-1-ylethylsulfanyl)ethyl]-1,3-thiazole |
| SMILES | Cc1ncsc1CCSCCn1cccn1 |
| InChI | InChI=1S/C11H15N3S2/c1-10-11(16-9-12-10)3-7-15-8-6-14-5-2-4-13-14/h2,4-5,9H,3,6-8H2,1H3 |
| InChIKey | CMAZCROKIMPPGG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|