C14H19N2S2+ — CID 164942754
4-methyl-5-[2-(3-pyridin-1-ium-1-ylpropylsulfanyl)ethyl]-1,3-thiazole (PubChem CID 164942754) has the molecular formula C14H19N2S2+ and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-methyl-5-[2-(3-pyridin-1-ium-1-ylpropylsulfanyl)ethyl]-1,3-thiazole.
| Compound Name | 4-methyl-5-[2-(3-pyridin-1-ium-1-ylpropylsulfanyl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 164942754 |
| Molecular Formula | C14H19N2S2+ |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-methyl-5-[2-(3-pyridin-1-ium-1-ylpropylsulfanyl)ethyl]-1,3-thiazole |
| SMILES | Cc1ncsc1CCSCCC[n+]1ccccc1 |
| InChI | InChI=1S/C14H19N2S2/c1-13-14(18-12-15-13)6-11-17-10-5-9-16-7-3-2-4-8-16/h2-4,7-8,12H,5-6,9-11H2,1H3/q+1 |
| InChIKey | UHSWRYAVZJZVOE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|