C11H15KN2O7S — CID 5334112
potassium N-[2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]-N-methylsulfamate (PubChem CID 5334112) has the molecular formula C11H15KN2O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is potassium N-[2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]-N-methylsulfamate.
| Compound Name | potassium N-[2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]-N-methylsulfamate |
|---|---|
| PubChem CID | 5334112 |
| Molecular Formula | C11H15KN2O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | potassium N-[2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]-N-methylsulfamate |
| SMILES | Cc1ccc(OCC(O)CN(C)S(=O)(=O)[O-])c([N+](=O)[O-])c1.[K+] |
| InChI | InChI=1S/C11H16N2O7S.K/c1-8-3-4-11(10(5-8)13(15)16)20-7-9(14)6-12(2)21(17,18)19;/h3-5,9,14H,6-7H2,1-2H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | QSWLMPOSYINIIA-UHFFFAOYSA-M |
| XLogP | -2.96 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|