C16H24N3O5+ — CID 6926944
1-[(2R)-2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]piperidin-1-ium-4-carboxamide (PubChem CID 6926944) has the molecular formula C16H24N3O5+ and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2R)-2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6926944 |
| Molecular Formula | C16H24N3O5+ |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-(4-methyl-2-nitrophenoxy)propyl]piperidin-1-ium-4-carboxamide |
| SMILES | Cc1ccc(OC[C@H](O)C[NH+]2CCC(C(N)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O5/c1-11-2-3-15(14(8-11)19(22)23)24-10-13(20)9-18-6-4-12(5-7-18)16(17)21/h2-3,8,12-13,20H,4-7,9-10H2,1H3,(H2,17,21)/p+1/t13-/m1/s1 |
| InChIKey | SKRBYZSAQPFRPY-CYBMUJFWSA-O |
| XLogP | -0.58 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|