C19H30N3O6S+ — CID 9291705
(2S)-1-[(3S)-3-methylpiperidin-1-ium-1-yl]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol (PubChem CID 9291705) has the molecular formula C19H30N3O6S+ and a molecular weight of 428.53 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-methylpiperidin-1-ium-1-yl]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[(3S)-3-methylpiperidin-1-ium-1-yl]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 9291705 |
| Molecular Formula | C19H30N3O6S+ |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (2S)-1-[(3S)-3-methylpiperidin-1-ium-1-yl]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol |
| SMILES | C[C@H]1CCC[NH+](C[C@H](O)COc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H29N3O6S/c1-15-5-4-8-20(12-15)13-16(23)14-28-19-7-6-17(11-18(19)22(24)25)29(26,27)21-9-2-3-10-21/h6-7,11,15-16,23H,2-5,8-10,12-14H2,1H3/p+1/t15-,16-/m0/s1 |
| InChIKey | GWHXNEACRWHVJR-HOTGVXAUSA-O |
| XLogP | 0.43 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|