C20H29N3O6S — CID 3518682
N-(2,3-dimethylcyclohexyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide (PubChem CID 3518682) has the molecular formula C20H29N3O6S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 3518682 |
| Molecular Formula | C20H29N3O6S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
| SMILES | CC1CCCC(NC(=O)COc2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])C1C |
| InChI | InChI=1S/C20H29N3O6S/c1-14-6-5-7-17(15(14)2)21-20(24)13-29-19-9-8-16(12-18(19)23(25)26)30(27,28)22-10-3-4-11-22/h8-9,12,14-15,17H,3-7,10-11,13H2,1-2H3,(H,21,24) |
| InChIKey | AOAFAOIUMHYXIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|