C23H34N2O5S — CID 5162087
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate (PubChem CID 5162087) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 5162087 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 4-(azepan-1-ylsulfonyl)benzoate |
| SMILES | CC1CCCC(NC(=O)COC(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)C1C |
| InChI | InChI=1S/C23H34N2O5S/c1-17-8-7-9-21(18(17)2)24-22(26)16-30-23(27)19-10-12-20(13-11-19)31(28,29)25-14-5-3-4-6-15-25/h10-13,17-18,21H,3-9,14-16H2,1-2H3,(H,24,26) |
| InChIKey | ZZVBLPZRUFNJPW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |