C21H27N3O7S — CID 51980694
(2R)-1-[(2-methoxyphenyl)methylamino]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol (PubChem CID 51980694) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is (2R)-1-[(2-methoxyphenyl)methylamino]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[(2-methoxyphenyl)methylamino]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 51980694 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (2R)-1-[(2-methoxyphenyl)methylamino]-3-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)propan-2-ol |
| SMILES | COc1ccccc1CNC[C@@H](O)COc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H27N3O7S/c1-30-20-7-3-2-6-16(20)13-22-14-17(25)15-31-21-9-8-18(12-19(21)24(26)27)32(28,29)23-10-4-5-11-23/h2-3,6-9,12,17,22,25H,4-5,10-11,13-15H2,1H3/t17-/m1/s1 |
| InChIKey | BPAIYUVFXUHVBR-QGZVFWFLSA-N |
| XLogP | 1.92 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|