C18H18F2N2O6S — CID 24604023
1-[4-[[2-(difluoromethoxy)phenyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine (PubChem CID 24604023) has the molecular formula C18H18F2N2O6S and a molecular weight of 428.41 g/mol. Its IUPAC name is 1-[4-[[2-(difluoromethoxy)phenyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-[[2-(difluoromethoxy)phenyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 24604023 |
| Molecular Formula | C18H18F2N2O6S |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-[4-[[2-(difluoromethoxy)phenyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OCc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H18F2N2O6S/c19-18(20)28-16-6-2-1-5-13(16)12-27-17-8-7-14(11-15(17)22(23)24)29(25,26)21-9-3-4-10-21/h1-2,5-8,11,18H,3-4,9-10,12H2 |
| InChIKey | UAMBCQOHORHEOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|