C17H17BrN2O5S — CID 3944903
1-[4-[(4-bromophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine (PubChem CID 3944903) has the molecular formula C17H17BrN2O5S and a molecular weight of 441.30 g/mol. Its IUPAC name is 1-[4-[(4-bromophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-[(4-bromophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 3944903 |
| Molecular Formula | C17H17BrN2O5S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 1-[4-[(4-bromophenyl)methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O5S/c18-14-5-3-13(4-6-14)12-25-17-8-7-15(11-16(17)20(21)22)26(23,24)19-9-1-2-10-19/h3-8,11H,1-2,9-10,12H2 |
| InChIKey | SGRJQHVDJKLTFF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|