C14H16Cl2N2O5S — CID 9353864
1-[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine (PubChem CID 9353864) has the molecular formula C14H16Cl2N2O5S and a molecular weight of 395.26 g/mol. Its IUPAC name is 1-[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine.
| Compound Name | 1-[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 9353864 |
| Molecular Formula | C14H16Cl2N2O5S |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 1-[4-[[(1R)-2,2-dichlorocyclopropyl]methoxy]-3-nitrophenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1OC[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2N2O5S/c15-14(16)8-10(14)9-23-13-4-3-11(7-12(13)18(19)20)24(21,22)17-5-1-2-6-17/h3-4,7,10H,1-2,5-6,8-9H2/t10-/m1/s1 |
| InChIKey | KPTMUXHZQYAFOS-SNVBAGLBSA-N |
| XLogP | 2.95 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|