C21H20N2O7S — CID 4532337
7-methyl-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]chromen-2-one (PubChem CID 4532337) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is 7-methyl-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]chromen-2-one.
| Compound Name | 7-methyl-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]chromen-2-one |
|---|---|
| PubChem CID | 4532337 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 7-methyl-4-[(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(COc3ccc(S(=O)(=O)N4CCCC4)cc3[N+](=O)[O-])cc(=O)oc2c1 |
| InChI | InChI=1S/C21H20N2O7S/c1-14-4-6-17-15(11-21(24)30-20(17)10-14)13-29-19-7-5-16(12-18(19)23(25)26)31(27,28)22-8-2-3-9-22/h4-7,10-12H,2-3,8-9,13H2,1H3 |
| InChIKey | IWMWWKODZLPLNJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|