C24H25NO6S — CID 29376149
(7-methyl-2-oxochromen-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 29376149) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 29376149 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 4-(4-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(S(=O)(=O)N4CCC(C)CC4)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H25NO6S/c1-16-9-11-25(12-10-16)32(28,29)20-6-4-18(5-7-20)24(27)30-15-19-14-23(26)31-22-13-17(2)3-8-21(19)22/h3-8,13-14,16H,9-12,15H2,1-2H3 |
| InChIKey | KJEVOGRGSLPCPJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|