C24H21ClF3NO6S — CID 2484224
(7-methyl-2-oxochromen-4-yl)methyl 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 2484224) has the molecular formula C24H21ClF3NO6S and a molecular weight of 543.95 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 2484224 |
| Molecular Formula | C24H21ClF3NO6S |
| Molecular Weight | 543.95 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)C3CCN(S(=O)(=O)c4ccc(Cl)c(C(F)(F)F)c4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H21ClF3NO6S/c1-14-2-4-18-16(11-22(30)35-21(18)10-14)13-34-23(31)15-6-8-29(9-7-15)36(32,33)17-3-5-20(25)19(12-17)24(26,27)28/h2-5,10-12,15H,6-9,13H2,1H3 |
| InChIKey | AOHZMUUSLVCCTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|