C22H20ClNO6S — CID 2628583
(7-methyl-2-oxochromen-4-yl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2628583) has the molecular formula C22H20ClNO6S and a molecular weight of 461.92 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2628583 |
| Molecular Formula | C22H20ClNO6S |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccc(Cl)c(S(=O)(=O)N4CCCC4)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H20ClNO6S/c1-14-4-6-17-16(12-21(25)30-19(17)10-14)13-29-22(26)15-5-7-18(23)20(11-15)31(27,28)24-8-2-3-9-24/h4-7,10-12H,2-3,8-9,13H2,1H3 |
| InChIKey | ITQNEUZEVHCPKB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|