C22H20FNO8S — CID 5163874
(7-methoxy-2-oxochromen-4-yl)methyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 5163874) has the molecular formula C22H20FNO8S and a molecular weight of 477.47 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 5163874 |
| Molecular Formula | C22H20FNO8S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc2c(COC(=O)c3ccc(F)c(S(=O)(=O)N4CCOCC4)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H20FNO8S/c1-29-16-3-4-17-15(11-21(25)32-19(17)12-16)13-31-22(26)14-2-5-18(23)20(10-14)33(27,28)24-6-8-30-9-7-24/h2-5,10-12H,6-9,13H2,1H3 |
| InChIKey | XUWSGKBHPZRJNR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|