C26H23NO6S — CID 2116758
(3-oxobenzo[f]chromen-1-yl)methyl 4-piperidin-1-ylsulfonylbenzoate (PubChem CID 2116758) has the molecular formula C26H23NO6S and a molecular weight of 477.54 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 4-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2116758 |
| Molecular Formula | C26H23NO6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cc(=O)oc2ccc3ccccc3c12)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H23NO6S/c28-24-16-20(25-22-7-3-2-6-18(22)10-13-23(25)33-24)17-32-26(29)19-8-11-21(12-9-19)34(30,31)27-14-4-1-5-15-27/h2-3,6-13,16H,1,4-5,14-15,17H2 |
| InChIKey | HMBGRZWSHXVZGZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|