C27H25NO6S — CID 3503609
(3-oxobenzo[f]chromen-1-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 3503609) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3503609 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-methyl-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C27H25NO6S/c1-18-9-11-21(35(31,32)28-13-5-2-6-14-28)16-23(18)27(30)33-17-20-15-25(29)34-24-12-10-19-7-3-4-8-22(19)26(20)24/h3-4,7-12,15-16H,2,5-6,13-14,17H2,1H3 |
| InChIKey | JHFFHJUVBOITHS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|