C23H23NO8S — CID 40619686
(7-hydroxy-2-oxochromen-4-yl)methyl 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 40619686) has the molecular formula C23H23NO8S and a molecular weight of 473.50 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 40619686 |
| Molecular Formula | C23H23NO8S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cccc(C(=O)OCc3cc(=O)oc4cc(O)ccc34)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H23NO8S/c1-14-11-24(12-15(2)31-14)33(28,29)19-5-3-4-16(8-19)23(27)30-13-17-9-22(26)32-21-10-18(25)6-7-20(17)21/h3-10,14-15,25H,11-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | FKKXHLKYQGAJFE-GJZGRUSLSA-N |
| XLogP | 2.65 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|