C11H9F3N2O3 — CID 103368368
3,3,3-trifluoro-2-[(4-methyl-2-nitrophenoxy)methyl]propanenitrile (PubChem CID 103368368) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-methyl-2-nitrophenoxy)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(4-methyl-2-nitrophenoxy)methyl]propanenitrile |
|---|---|
| PubChem CID | 103368368 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-methyl-2-nitrophenoxy)methyl]propanenitrile |
| SMILES | Cc1ccc(OCC(C#N)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9F3N2O3/c1-7-2-3-10(9(4-7)16(17)18)19-6-8(5-15)11(12,13)14/h2-4,8H,6H2,1H3 |
| InChIKey | WWBBARJJGBSACS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|