C11H9F3N2O4 — CID 103368358
3,3,3-trifluoro-2-[(4-methoxy-2-nitrophenoxy)methyl]propanenitrile (PubChem CID 103368358) has the molecular formula C11H9F3N2O4 and a molecular weight of 290.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-methoxy-2-nitrophenoxy)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(4-methoxy-2-nitrophenoxy)methyl]propanenitrile |
|---|---|
| PubChem CID | 103368358 |
| Molecular Formula | C11H9F3N2O4 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-methoxy-2-nitrophenoxy)methyl]propanenitrile |
| SMILES | COc1ccc(OCC(C#N)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9F3N2O4/c1-19-8-2-3-10(9(4-8)16(17)18)20-6-7(5-15)11(12,13)14/h2-4,7H,6H2,1H3 |
| InChIKey | XRBHYKRTTXSCFN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|