C17H18N2O4S — CID 94817997
(5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 94817997) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94817997 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (5R)-3-[(2R)-2-hydroxy-3-phenoxypropyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccsc2)NC(=O)N(C[C@@H](O)COc2ccccc2)C1=O |
| InChI | InChI=1S/C17H18N2O4S/c1-17(12-7-8-24-11-12)15(21)19(16(22)18-17)9-13(20)10-23-14-5-3-2-4-6-14/h2-8,11,13,20H,9-10H2,1H3,(H,18,22)/t13-,17-/m1/s1 |
| InChIKey | JZNPIKUVBQZBJK-CXAGYDPISA-N |
| XLogP | 1.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|