C18H20N2O3S — CID 111476750
3-[2-(3,5-dimethylphenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 111476750) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(3,5-dimethylphenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 111476750 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)-2-hydroxyethyl]-5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C)cc(C(O)CN2C(=O)NC(C)(c3ccsc3)C2=O)c1 |
| InChI | InChI=1S/C18H20N2O3S/c1-11-6-12(2)8-13(7-11)15(21)9-20-16(22)18(3,19-17(20)23)14-4-5-24-10-14/h4-8,10,15,21H,9H2,1-3H3,(H,19,23) |
| InChIKey | LVRPXLNQPUDKRN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|