C12H12N4O3S — CID 124573291
(5R)-5-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-5-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 124573291) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is (5R)-5-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-5-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-5-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124573291 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (5R)-5-methyl-3-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-5-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | Cc1nnc(CN2C(=O)N[C@](C)(c3ccsc3)C2=O)o1 |
| InChI | InChI=1S/C12H12N4O3S/c1-7-14-15-9(19-7)5-16-10(17)12(2,13-11(16)18)8-3-4-20-6-8/h3-4,6H,5H2,1-2H3,(H,13,18)/t12-/m1/s1 |
| InChIKey | ZLJWLAPZQSOWMT-GFCCVEGCSA-N |
| XLogP | 1.41 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|