C16H12FN3O2S — CID 94813765
3-fluoro-4-[[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 94813765) has the molecular formula C16H12FN3O2S and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-fluoro-4-[[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 94813765 |
| Molecular Formula | C16H12FN3O2S |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-fluoro-4-[[(4R)-4-methyl-2,5-dioxo-4-thiophen-3-ylimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | C[C@]1(c2ccsc2)NC(=O)N(Cc2ccc(C#N)cc2F)C1=O |
| InChI | InChI=1S/C16H12FN3O2S/c1-16(12-4-5-23-9-12)14(21)20(15(22)19-16)8-11-3-2-10(7-18)6-13(11)17/h2-6,9H,8H2,1H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | LVTYIWWHYVUUKD-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|