C14H12FN3OS — CID 56827508
1-[(4-cyano-2-fluorophenyl)methyl]-3-(thiophen-3-ylmethyl)urea (PubChem CID 56827508) has the molecular formula C14H12FN3OS and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 56827508 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-(thiophen-3-ylmethyl)urea |
| SMILES | N#Cc1ccc(CNC(=O)NCc2ccsc2)c(F)c1 |
| InChI | InChI=1S/C14H12FN3OS/c15-13-5-10(6-16)1-2-12(13)8-18-14(19)17-7-11-3-4-20-9-11/h1-5,9H,7-8H2,(H2,17,18,19) |
| InChIKey | IZBYVSRNRAQRJO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |