C17H18FN5O — CID 56827507
1-[(4-cyano-2-fluorophenyl)methyl]-3-[[6-(dimethylamino)-3-pyridinyl]methyl]urea (PubChem CID 56827507) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-3-[[6-(dimethylamino)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[[6-(dimethylamino)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 56827507 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[[6-(dimethylamino)-3-pyridinyl]methyl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)NCc2ccc(C#N)cc2F)cn1 |
| InChI | InChI=1S/C17H18FN5O/c1-23(2)16-6-4-13(9-20-16)10-21-17(24)22-11-14-5-3-12(8-19)7-15(14)18/h3-7,9H,10-11H2,1-2H3,(H2,21,22,24) |
| InChIKey | IACMUICVILHLBW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |