C16H18FN5O2 — CID 111459097
1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 111459097) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 111459097 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | Cn1cc(C(C)(O)CNC(=O)NCc2ccc(C#N)cc2F)cn1 |
| InChI | InChI=1S/C16H18FN5O2/c1-16(24,13-8-21-22(2)9-13)10-20-15(23)19-7-12-4-3-11(6-18)5-14(12)17/h3-5,8-9,24H,7,10H2,1-2H3,(H2,19,20,23) |
| InChIKey | MFXLZVMCELGRNM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |