C15H17N5O2 — CID 111457911
1-(3-cyanophenyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 111457911) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 111457911 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | Cn1cc(C(C)(O)CNC(=O)Nc2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C15H17N5O2/c1-15(22,12-8-18-20(2)9-12)10-17-14(21)19-13-5-3-4-11(6-13)7-16/h3-6,8-9,22H,10H2,1-2H3,(H2,17,19,21) |
| InChIKey | BQLNJXRSIVUQCD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |