C20H26N6O2 — CID 111655440
2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide (PubChem CID 111655440) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide.
| Compound Name | 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide |
|---|---|
| PubChem CID | 111655440 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(3-ethynylphenyl)acetamide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\NCC)NCC(C)(O)c2cnn(C)c2)c1 |
| InChI | InChI=1S/C20H26N6O2/c1-5-15-8-7-9-17(10-15)25-18(27)12-22-19(21-6-2)23-14-20(3,28)16-11-24-26(4)13-16/h1,7-11,13,28H,6,12,14H2,2-4H3,(H,25,27)(H2,21,22,23) |
| InChIKey | PGBAAPGNRVMLSX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|