C15H28N6O3 — CID 111656672
2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111656672) has the molecular formula C15H28N6O3 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111656672 |
| Molecular Formula | C15H28N6O3 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-[[ethylamino-[[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C15H28N6O3/c1-5-16-14(18-9-13(22)17-6-7-24-4)19-11-15(2,23)12-8-20-21(3)10-12/h8,10,23H,5-7,9,11H2,1-4H3,(H,17,22)(H2,16,18,19) |
| InChIKey | ZFJNCFISSSOATB-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|