C22H23N3O5 — CID 55410170
2-[4-[2-hydroxy-3-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propoxy]phenyl]acetonitrile (PubChem CID 55410170) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[4-[2-hydroxy-3-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propoxy]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-hydroxy-3-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propoxy]phenyl]acetonitrile |
|---|---|
| PubChem CID | 55410170 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[4-[2-hydroxy-3-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propoxy]phenyl]acetonitrile |
| SMILES | COc1cccc(C2(C)NC(=O)N(CC(O)COc3ccc(CC#N)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-22(16-4-3-5-19(12-16)29-2)20(27)25(21(28)24-22)13-17(26)14-30-18-8-6-15(7-9-18)10-11-23/h3-9,12,17,26H,10,13-14H2,1-2H3,(H,24,28) |
| InChIKey | UFOOEFBVCIFVFS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|