C12H15NO4S — CID 130448245
methyl 2-methyl-3-(4-sulfamoylphenyl)cyclopropane-1-carboxylate (PubChem CID 130448245) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl 2-methyl-3-(4-sulfamoylphenyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 2-methyl-3-(4-sulfamoylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 130448245 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 2-methyl-3-(4-sulfamoylphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1C(C)C1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-7-10(11(7)12(14)17-2)8-3-5-9(6-4-8)18(13,15)16/h3-7,10-11H,1-2H3,(H2,13,15,16) |
| InChIKey | VBDGVPGQRMGYBM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |