C11H11N3O4S3 — CID 3639086
methyl 4-imino-3-(4-sulfamoylphenyl)-2-sulfanylidene-1,3-thiazolidine-5-carboxylate (PubChem CID 3639086) has the molecular formula C11H11N3O4S3 and a molecular weight of 345.43 g/mol. Its IUPAC name is methyl 4-imino-3-(4-sulfamoylphenyl)-2-sulfanylidene-1,3-thiazolidine-5-carboxylate.
| Compound Name | methyl 4-imino-3-(4-sulfamoylphenyl)-2-sulfanylidene-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 3639086 |
| Molecular Formula | C11H11N3O4S3 |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | methyl 4-imino-3-(4-sulfamoylphenyl)-2-sulfanylidene-1,3-thiazolidine-5-carboxylate |
| SMILES | [H]/N=C1\C(C(=O)OC)SC(=S)N1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H11N3O4S3/c1-18-10(15)8-9(12)14(11(19)20-8)6-2-4-7(5-3-6)21(13,16)17/h2-5,8,12H,1H3,(H2,13,16,17)/b12-9+ |
| InChIKey | KHVINIOMZYCXLQ-FMIVXFBMSA-N |
| XLogP | 0.69 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|