C11H12N4O4S — CID 107346221
methyl 4-amino-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate (PubChem CID 107346221) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is methyl 4-amino-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-amino-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 107346221 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | methyl 4-amino-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(S(N)(=O)=O)cc2)cc1N |
| InChI | InChI=1S/C11H12N4O4S/c1-19-11(16)10-9(12)6-15(14-10)7-2-4-8(5-3-7)20(13,17)18/h2-6H,12H2,1H3,(H2,13,17,18) |
| InChIKey | XHIXHHLMKIIXHG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 130.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |