C18H15Cl2N3O5S — CID 91133842
(3,5-dichloro-4-methoxyphenyl) 4-methyl-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate (PubChem CID 91133842) has the molecular formula C18H15Cl2N3O5S and a molecular weight of 456.31 g/mol. Its IUPAC name is (3,5-dichloro-4-methoxyphenyl) 4-methyl-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate.
| Compound Name | (3,5-dichloro-4-methoxyphenyl) 4-methyl-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 91133842 |
| Molecular Formula | C18H15Cl2N3O5S |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | (3,5-dichloro-4-methoxyphenyl) 4-methyl-1-(4-sulfamoylphenyl)pyrazole-3-carboxylate |
| SMILES | COc1c(Cl)cc(OC(=O)c2nn(-c3ccc(S(N)(=O)=O)cc3)cc2C)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O5S/c1-10-9-23(11-3-5-13(6-4-11)29(21,25)26)22-16(10)18(24)28-12-7-14(19)17(27-2)15(20)8-12/h3-9H,1-2H3,(H2,21,25,26) |
| InChIKey | DSZUBJGDMXWIEA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|