C12H8Cl2N2O3 — CID 94712373
methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate (PubChem CID 94712373) has the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. Its IUPAC name is methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate.
| Compound Name | methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 94712373 |
| Molecular Formula | C12H8Cl2N2O3 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)cc1C=O |
| InChI | InChI=1S/C12H8Cl2N2O3/c1-19-12(18)11-7(6-17)5-16(15-11)8-2-3-9(13)10(14)4-8/h2-6H,1H3 |
| InChIKey | PSUBWMYHADYOLJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|