methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate

C12H8Cl2N2O3 — CID 94712373

IUPACmethyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate
SMILESCOC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)cc1C=O
InChIInChI=1S/C12H8Cl2N2O3/c1-19-12(18)11-7(6-17)5-16(15-11)8-2-3-9(13)10(14)4-8/h2-6H,1H3
InChIKeyPSUBWMYHADYOLJ-UHFFFAOYSA-N
MW299.11 g/mol
LogP2.78
Rot. Bonds3

About methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate

methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate (PubChem CID 94712373) has the molecular formula C12H8Cl2N2O3 and a molecular weight of 299.11 g/mol. Its IUPAC name is methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate
PubChem CID94712373
Molecular FormulaC12H8Cl2N2O3
Molecular Weight299.11 g/mol
Exact Mass297.99
IUPAC Namemethyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate
SMILESCOC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)cc1C=O
InChIInChI=1S/C12H8Cl2N2O3/c1-19-12(18)11-7(6-17)5-16(15-11)8-2-3-9(13)10(14)4-8/h2-6H,1H3
InChIKeyPSUBWMYHADYOLJ-UHFFFAOYSA-N
XLogP2.78
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.11
LogP ≤ 52.78
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate?
The IUPAC name of methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate (CID 94712373) is methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate.
What is the SMILES notation for methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate?
The canonical SMILES for methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate is COC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)cc1C=O.
What is the InChIKey of methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate?
The InChIKey is PSUBWMYHADYOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O3/c1-19-12(18)11-7(6-17)5-16(15-11)8-2-3-9(13)10(14)4-8/h2-6H,1H3.
What are the key properties of methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate?
methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate has a molecular weight of 299.11 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(3,4-dichlorophenyl)-4-formylpyrazole-3-carboxylate is sourced from PubChem (CID 94712373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).