About methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate
methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 95909870) has the molecular formula C11H9Cl2N3O2
and a molecular weight of 286.12 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate.
Analyze methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The IUPAC name of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate (CID 95909870) is methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate.
What is the SMILES notation for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The canonical SMILES for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate is COC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)nc1C.
What is the InChIKey of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The InChIKey is JMMHUZQEFDEMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3O2/c1-6-10(11(17)18-2)15-16(14-6)7-3-4-8(12)9(13)5-7/h3-5H,1-2H3.
What are the key properties of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate has a molecular weight of 286.12 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate is sourced from PubChem (CID 95909870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).