methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate

C11H9Cl2N3O2 — CID 95909870

IUPACmethyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate
SMILESCOC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)nc1C
InChIInChI=1S/C11H9Cl2N3O2/c1-6-10(11(17)18-2)15-16(14-6)7-3-4-8(12)9(13)5-7/h3-5H,1-2H3
InChIKeyJMMHUZQEFDEMKA-UHFFFAOYSA-N
MW286.12 g/mol
LogP2.67
Rot. Bonds2

About methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate

methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 95909870) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate
PubChem CID95909870
Molecular FormulaC11H9Cl2N3O2
Molecular Weight286.12 g/mol
Exact Mass285.01
IUPAC Namemethyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate
SMILESCOC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)nc1C
InChIInChI=1S/C11H9Cl2N3O2/c1-6-10(11(17)18-2)15-16(14-6)7-3-4-8(12)9(13)5-7/h3-5H,1-2H3
InChIKeyJMMHUZQEFDEMKA-UHFFFAOYSA-N
XLogP2.67
TPSA57.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.12
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The IUPAC name of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate (CID 95909870) is methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate.
What is the SMILES notation for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The canonical SMILES for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate is COC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)nc1C.
What is the InChIKey of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
The InChIKey is JMMHUZQEFDEMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3O2/c1-6-10(11(17)18-2)15-16(14-6)7-3-4-8(12)9(13)5-7/h3-5H,1-2H3.
What are the key properties of methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate?
methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate has a molecular weight of 286.12 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate is sourced from PubChem (CID 95909870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).