C13H9Cl2N3O2 — CID 95909867
prop-2-ynyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 95909867) has the molecular formula C13H9Cl2N3O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is prop-2-ynyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-ynyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 95909867 |
| Molecular Formula | C13H9Cl2N3O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | prop-2-ynyl 2-(3,4-dichlorophenyl)-5-methyltriazole-4-carboxylate |
| SMILES | C#CCOC(=O)c1nn(-c2ccc(Cl)c(Cl)c2)nc1C |
| InChI | InChI=1S/C13H9Cl2N3O2/c1-3-6-20-13(19)12-8(2)16-18(17-12)9-4-5-10(14)11(15)7-9/h1,4-5,7H,6H2,2H3 |
| InChIKey | NAJATIZCPWJAQW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|