C12H11ClN4O2 — CID 143035594
1-(3-chloro-4-methylphenyl)-4-formamidopyrazole-3-carboxamide (PubChem CID 143035594) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4-formamidopyrazole-3-carboxamide.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4-formamidopyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143035594 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4-formamidopyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2cc(NC=O)c(C(N)=O)n2)cc1Cl |
| InChI | InChI=1S/C12H11ClN4O2/c1-7-2-3-8(4-9(7)13)17-5-10(15-6-18)11(16-17)12(14)19/h2-6H,1H3,(H2,14,19)(H,15,18) |
| InChIKey | KESZRBFXGSZHAW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|