C21H18ClN3O5S — CID 67725470
ethyl 6-chloro-7-methoxy-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxylate (PubChem CID 67725470) has the molecular formula C21H18ClN3O5S and a molecular weight of 459.91 g/mol. Its IUPAC name is ethyl 6-chloro-7-methoxy-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxylate.
| Compound Name | ethyl 6-chloro-7-methoxy-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxylate |
|---|---|
| PubChem CID | 67725470 |
| Molecular Formula | C21H18ClN3O5S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | ethyl 6-chloro-7-methoxy-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(S(N)(=O)=O)cc2)c2c1ccc1c(Cl)c(OC)ccc12 |
| InChI | InChI=1S/C21H18ClN3O5S/c1-3-30-21(26)19-16-9-8-14-15(10-11-17(29-2)18(14)22)20(16)25(24-19)12-4-6-13(7-5-12)31(23,27)28/h4-11H,3H2,1-2H3,(H2,23,27,28) |
| InChIKey | AEGKHWHYCZROFX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |